C24H30O9 — CID 163185785
[(1R,2S,6R,7R,9S)-13-(acetyloxymethyl)-9-methyl-5-methylidene-4-oxo-3,14-dioxatricyclo[7.4.1.02,6]tetradec-12-en-7-yl] (Z)-2-(acetyloxymethyl)but-2-enoate (PubChem CID 163185785) has the molecular formula C24H30O9 and a molecular weight of 462.50 g/mol. Its IUPAC name is [(1R,2S,6R,7R,9S)-13-(acetyloxymethyl)-9-methyl-5-methylidene-4-oxo-3,14-dioxatricyclo[7.4.1.02,6]tetradec-12-en-7-yl] (Z)-2-(acetyloxymethyl)but-2-enoate.
| Compound Name | [(1R,2S,6R,7R,9S)-13-(acetyloxymethyl)-9-methyl-5-methylidene-4-oxo-3,14-dioxatricyclo[7.4.1.02,6]tetradec-12-en-7-yl] (Z)-2-(acetyloxymethyl)but-2-enoate |
|---|---|
| PubChem CID | 163185785 |
| Molecular Formula | C24H30O9 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | [(1R,2S,6R,7R,9S)-13-(acetyloxymethyl)-9-methyl-5-methylidene-4-oxo-3,14-dioxatricyclo[7.4.1.02,6]tetradec-12-en-7-yl] (Z)-2-(acetyloxymethyl)but-2-enoate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1[C@H](OC(=O)/C(=C\C)COC(C)=O)C[C@]1(C)CCC=C(COC(C)=O)[C@H]2O1 |
| InChI | InChI=1S/C24H30O9/c1-6-16(11-29-14(3)25)23(28)31-18-10-24(5)9-7-8-17(12-30-15(4)26)20(33-24)21-19(18)13(2)22(27)32-21/h6,8,18-21H,2,7,9-12H2,1,3-5H3/b16-6-/t18-,19-,20-,21+,24+/m1/s1 |
| InChIKey | RRQGQDVZBGGNIZ-IOXWMCIOSA-N |
| XLogP | 2.34 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|