C19H32O — CID 163185843
(3S)-5-[(1S,2R,8aR)-1,2,5-trimethyl-3,7,8,8a-tetrahydro-2H-naphthalen-1-yl]-3-methylpentan-1-ol (PubChem CID 163185843) has the molecular formula C19H32O and a molecular weight of 276.46 g/mol. Its IUPAC name is (3S)-5-[(1S,2R,8aR)-1,2,5-trimethyl-3,7,8,8a-tetrahydro-2H-naphthalen-1-yl]-3-methylpentan-1-ol.
| Compound Name | (3S)-5-[(1S,2R,8aR)-1,2,5-trimethyl-3,7,8,8a-tetrahydro-2H-naphthalen-1-yl]-3-methylpentan-1-ol |
|---|---|
| PubChem CID | 163185843 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | (3S)-5-[(1S,2R,8aR)-1,2,5-trimethyl-3,7,8,8a-tetrahydro-2H-naphthalen-1-yl]-3-methylpentan-1-ol |
| SMILES | CC1=CCC[C@H]2C1=CC[C@@H](C)[C@]2(C)CC[C@H](C)CCO |
| InChI | InChI=1S/C19H32O/c1-14(11-13-20)10-12-19(4)16(3)8-9-17-15(2)6-5-7-18(17)19/h6,9,14,16,18,20H,5,7-8,10-13H2,1-4H3/t14-,16+,18-,19-/m0/s1 |
| InChIKey | RJMXJNWRFOQGAE-FXECBMLZSA-N |
| XLogP | 5.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |