C25H34N2O6 — CID 163186049
(1S,2R,5S,6E,7S,8R,9S,10S)-6-ethylidene-5,9,13-trihydroxy-11,20-dimethyl-8-propan-2-yl-4-oxa-11,20-diazapentacyclo[8.7.3.01,10.02,7.012,17]icosa-12(17),13,15-triene-2-carboxylic acid (PubChem CID 163186049) has the molecular formula C25H34N2O6 and a molecular weight of 458.56 g/mol. Its IUPAC name is (1S,2R,5S,6E,7S,8R,9S,10S)-6-ethylidene-5,9,13-trihydroxy-11,20-dimethyl-8-propan-2-yl-4-oxa-11,20-diazapentacyclo[8.7.3.01,10.02,7.012,17]icosa-12(17),13,15-triene-2-carboxylic acid.
| Compound Name | (1S,2R,5S,6E,7S,8R,9S,10S)-6-ethylidene-5,9,13-trihydroxy-11,20-dimethyl-8-propan-2-yl-4-oxa-11,20-diazapentacyclo[8.7.3.01,10.02,7.012,17]icosa-12(17),13,15-triene-2-carboxylic acid |
|---|---|
| PubChem CID | 163186049 |
| Molecular Formula | C25H34N2O6 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | (1S,2R,5S,6E,7S,8R,9S,10S)-6-ethylidene-5,9,13-trihydroxy-11,20-dimethyl-8-propan-2-yl-4-oxa-11,20-diazapentacyclo[8.7.3.01,10.02,7.012,17]icosa-12(17),13,15-triene-2-carboxylic acid |
| SMILES | C/C=C1\[C@@H]2[C@@H](C(C)C)[C@H](O)[C@]34N(C)CC[C@]3(c3cccc(O)c3N4C)[C@@]2(C(=O)O)CO[C@@H]1O |
| InChI | InChI=1S/C25H34N2O6/c1-6-14-18-17(13(2)3)20(29)25-24(10-11-26(25)4,23(18,22(31)32)12-33-21(14)30)15-8-7-9-16(28)19(15)27(25)5/h6-9,13,17-18,20-21,28-30H,10-12H2,1-5H3,(H,31,32)/b14-6-/t17-,18-,20+,21+,23+,24+,25-/m1/s1 |
| InChIKey | ZWTKVKLDLQBSRB-FAHONDAUSA-N |
| XLogP | 1.74 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|