C13H19NO3 — CID 163186228
(3'S,9S,9aR)-3'-methylspiro[2,5,6,7,8,9a-hexahydro-1H-pyrrolo[1,2-a]azepine-9,5'-oxolane]-2',3-dione (PubChem CID 163186228) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is (3'S,9S,9aR)-3'-methylspiro[2,5,6,7,8,9a-hexahydro-1H-pyrrolo[1,2-a]azepine-9,5'-oxolane]-2',3-dione.
| Compound Name | (3'S,9S,9aR)-3'-methylspiro[2,5,6,7,8,9a-hexahydro-1H-pyrrolo[1,2-a]azepine-9,5'-oxolane]-2',3-dione |
|---|---|
| PubChem CID | 163186228 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | (3'S,9S,9aR)-3'-methylspiro[2,5,6,7,8,9a-hexahydro-1H-pyrrolo[1,2-a]azepine-9,5'-oxolane]-2',3-dione |
| SMILES | C[C@H]1C[C@]2(CCCCN3C(=O)CC[C@@H]32)OC1=O |
| InChI | InChI=1S/C13H19NO3/c1-9-8-13(17-12(9)16)6-2-3-7-14-10(13)4-5-11(14)15/h9-10H,2-8H2,1H3/t9-,10+,13-/m0/s1 |
| InChIKey | BNTLJWHMOCJBCZ-CWSCBRNRSA-N |
| XLogP | 1.48 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |