C19H32O2 — CID 163186518
(4aS,8aS)-4-[(3R)-5-hydroxy-3-methylpentyl]-4a,8,8-trimethyl-5,6,7,8a-tetrahydro-1H-naphthalen-2-one (PubChem CID 163186518) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is (4aS,8aS)-4-[(3R)-5-hydroxy-3-methylpentyl]-4a,8,8-trimethyl-5,6,7,8a-tetrahydro-1H-naphthalen-2-one.
| Compound Name | (4aS,8aS)-4-[(3R)-5-hydroxy-3-methylpentyl]-4a,8,8-trimethyl-5,6,7,8a-tetrahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 163186518 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | (4aS,8aS)-4-[(3R)-5-hydroxy-3-methylpentyl]-4a,8,8-trimethyl-5,6,7,8a-tetrahydro-1H-naphthalen-2-one |
| SMILES | C[C@@H](CCO)CCC1=CC(=O)C[C@H]2C(C)(C)CCC[C@]12C |
| InChI | InChI=1S/C19H32O2/c1-14(8-11-20)6-7-15-12-16(21)13-17-18(2,3)9-5-10-19(15,17)4/h12,14,17,20H,5-11,13H2,1-4H3/t14-,17+,19-/m1/s1 |
| InChIKey | NRKQQDUSFYIZFS-DKSSEZFCSA-N |
| XLogP | 4.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |