C17H21NO — CID 163186899
(3E,5E)-1-[(2R)-1-methylpyrrolidin-2-yl]-6-phenylhexa-3,5-dien-2-one (PubChem CID 163186899) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is (3E,5E)-1-[(2R)-1-methylpyrrolidin-2-yl]-6-phenylhexa-3,5-dien-2-one.
| Compound Name | (3E,5E)-1-[(2R)-1-methylpyrrolidin-2-yl]-6-phenylhexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 163186899 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | (3E,5E)-1-[(2R)-1-methylpyrrolidin-2-yl]-6-phenylhexa-3,5-dien-2-one |
| SMILES | CN1CCC[C@@H]1CC(=O)/C=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C17H21NO/c1-18-13-7-11-16(18)14-17(19)12-6-5-10-15-8-3-2-4-9-15/h2-6,8-10,12,16H,7,11,13-14H2,1H3/b10-5+,12-6+/t16-/m1/s1 |
| InChIKey | PEYDJQPYPIFSAO-OHXLYVNLSA-N |
| XLogP | 3.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|