C16H20O — CID 163187077
(4E,6S,7E)-4,6-dimethyl-8-phenylocta-4,7-dien-2-one (PubChem CID 163187077) has the molecular formula C16H20O and a molecular weight of 228.34 g/mol. Its IUPAC name is (4E,6S,7E)-4,6-dimethyl-8-phenylocta-4,7-dien-2-one.
| Compound Name | (4E,6S,7E)-4,6-dimethyl-8-phenylocta-4,7-dien-2-one |
|---|---|
| PubChem CID | 163187077 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (4E,6S,7E)-4,6-dimethyl-8-phenylocta-4,7-dien-2-one |
| SMILES | CC(=O)C/C(C)=C/[C@@H](C)/C=C/c1ccccc1 |
| InChI | InChI=1S/C16H20O/c1-13(11-14(2)12-15(3)17)9-10-16-7-5-4-6-8-16/h4-11,13H,12H2,1-3H3/b10-9+,14-11+/t13-/m0/s1 |
| InChIKey | YJDWKXOTCMKVRE-NDBRTZQOSA-N |
| XLogP | 4.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|