C24H36O5 — CID 163187119
[(1E,3S,4R,7E,12S)-3-acetyloxy-12-hydroxy-7,11-dimethyl-4-prop-1-en-2-ylcyclotetradeca-1,7,10-trien-1-yl]methyl acetate (PubChem CID 163187119) has the molecular formula C24H36O5 and a molecular weight of 404.55 g/mol. Its IUPAC name is [(1E,3S,4R,7E,12S)-3-acetyloxy-12-hydroxy-7,11-dimethyl-4-prop-1-en-2-ylcyclotetradeca-1,7,10-trien-1-yl]methyl acetate.
| Compound Name | [(1E,3S,4R,7E,12S)-3-acetyloxy-12-hydroxy-7,11-dimethyl-4-prop-1-en-2-ylcyclotetradeca-1,7,10-trien-1-yl]methyl acetate |
|---|---|
| PubChem CID | 163187119 |
| Molecular Formula | C24H36O5 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | [(1E,3S,4R,7E,12S)-3-acetyloxy-12-hydroxy-7,11-dimethyl-4-prop-1-en-2-ylcyclotetradeca-1,7,10-trien-1-yl]methyl acetate |
| SMILES | C=C(C)[C@H]1CC/C(C)=C/CC=C(C)[C@@H](O)CC/C(COC(C)=O)=C\[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H36O5/c1-16(2)22-12-10-17(3)8-7-9-18(4)23(27)13-11-21(15-28-19(5)25)14-24(22)29-20(6)26/h8-9,14,22-24,27H,1,7,10-13,15H2,2-6H3/b17-8+,18-9?,21-14+/t22-,23+,24+/m1/s1 |
| InChIKey | VEMVDCAUWIBDLU-JRSRHVPASA-N |
| XLogP | 4.82 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|