C20H32O3 — CID 163187687
(1R,2S,5E,9E,12S,13S)-2,6,10-trimethyl-13-[(2R)-2-methyloxiran-2-yl]-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-2-ol (PubChem CID 163187687) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (1R,2S,5E,9E,12S,13S)-2,6,10-trimethyl-13-[(2R)-2-methyloxiran-2-yl]-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-2-ol.
| Compound Name | (1R,2S,5E,9E,12S,13S)-2,6,10-trimethyl-13-[(2R)-2-methyloxiran-2-yl]-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-2-ol |
|---|---|
| PubChem CID | 163187687 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (1R,2S,5E,9E,12S,13S)-2,6,10-trimethyl-13-[(2R)-2-methyloxiran-2-yl]-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-2-ol |
| SMILES | C/C1=C\CC[C@](C)(O)[C@H]2C[C@H]([C@]3(C)CO3)[C@H](C/C(C)=C/CC1)O2 |
| InChI | InChI=1S/C20H32O3/c1-14-7-5-8-15(2)11-17-16(20(4)13-22-20)12-18(23-17)19(3,21)10-6-9-14/h8-9,16-18,21H,5-7,10-13H2,1-4H3/b14-9+,15-8+/t16-,17-,18+,19-,20-/m0/s1 |
| InChIKey | CUMXILZMQFRPNI-QQIVVAOHSA-N |
| XLogP | 4.16 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|