C28H51NO8P+ — CID 163187731
2-[hydroxy-[(2R)-2-hydroxy-3-[(2S,7Z,12S)-2-methoxy-12-methyloctadeca-7,17-dien-5-ynoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 163187731) has the molecular formula C28H51NO8P+ and a molecular weight of 560.69 g/mol. Its IUPAC name is 2-[hydroxy-[(2R)-2-hydroxy-3-[(2S,7Z,12S)-2-methoxy-12-methyloctadeca-7,17-dien-5-ynoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[(2R)-2-hydroxy-3-[(2S,7Z,12S)-2-methoxy-12-methyloctadeca-7,17-dien-5-ynoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 163187731 |
| Molecular Formula | C28H51NO8P+ |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.33 |
| IUPAC Name | 2-[hydroxy-[(2R)-2-hydroxy-3-[(2S,7Z,12S)-2-methoxy-12-methyloctadeca-7,17-dien-5-ynoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | C=CCCCC[C@H](C)CCC/C=C\C#CCC[C@H](OC)C(=O)OC[C@@H](O)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C28H50NO8P/c1-7-8-9-15-18-25(2)19-16-13-11-10-12-14-17-20-27(34-6)28(31)35-23-26(30)24-37-38(32,33)36-22-21-29(3,4)5/h7,10-11,25-27,30H,1,8-9,13,15-24H2,2-6H3/p+1/b11-10-/t25-,26+,27-/m0/s1 |
| InChIKey | DEHUAXGMZWQADO-BSQYKSRYSA-O |
| XLogP | 4.64 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|