C16H30O2 — CID 163187774
(E,6R,8S,10S)-10-hydroxy-4,6,8,10-tetramethyldodec-4-en-3-one (PubChem CID 163187774) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is (E,6R,8S,10S)-10-hydroxy-4,6,8,10-tetramethyldodec-4-en-3-one.
| Compound Name | (E,6R,8S,10S)-10-hydroxy-4,6,8,10-tetramethyldodec-4-en-3-one |
|---|---|
| PubChem CID | 163187774 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | (E,6R,8S,10S)-10-hydroxy-4,6,8,10-tetramethyldodec-4-en-3-one |
| SMILES | CCC(=O)/C(C)=C/[C@H](C)C[C@H](C)C[C@@](C)(O)CC |
| InChI | InChI=1S/C16H30O2/c1-7-15(17)14(5)10-12(3)9-13(4)11-16(6,18)8-2/h10,12-13,18H,7-9,11H2,1-6H3/b14-10+/t12-,13+,16+/m1/s1 |
| InChIKey | NFZDDCVNVZBRDV-FUDPKDBQSA-N |
| XLogP | 4.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|