C27H46O3 — CID 163188054
[(3R,7S,11S)-3-hydroxy-3,7,11,15-tetramethylhexadecyl] benzoate (PubChem CID 163188054) has the molecular formula C27H46O3 and a molecular weight of 418.66 g/mol. Its IUPAC name is [(3R,7S,11S)-3-hydroxy-3,7,11,15-tetramethylhexadecyl] benzoate.
| Compound Name | [(3R,7S,11S)-3-hydroxy-3,7,11,15-tetramethylhexadecyl] benzoate |
|---|---|
| PubChem CID | 163188054 |
| Molecular Formula | C27H46O3 |
| Molecular Weight | 418.66 g/mol |
| Exact Mass | 418.34 |
| IUPAC Name | [(3R,7S,11S)-3-hydroxy-3,7,11,15-tetramethylhexadecyl] benzoate |
| SMILES | CC(C)CCC[C@H](C)CCC[C@H](C)CCC[C@@](C)(O)CCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H46O3/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-19-27(5,29)20-21-30-26(28)25-17-7-6-8-18-25/h6-8,17-18,22-24,29H,9-16,19-21H2,1-5H3/t23-,24-,27+/m0/s1 |
| InChIKey | GAMTYFUXKUANAW-NLJOTIRTSA-N |
| XLogP | 7.42 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.66 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |