C20H32O3 — CID 163188190
(4S,6R,9S,10S,11S)-6-methyl-9-[(2R)-6-methylhept-5-en-2-yl]-5,12-dioxatricyclo[8.3.0.04,6]tridec-1-en-11-ol (PubChem CID 163188190) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (4S,6R,9S,10S,11S)-6-methyl-9-[(2R)-6-methylhept-5-en-2-yl]-5,12-dioxatricyclo[8.3.0.04,6]tridec-1-en-11-ol.
| Compound Name | (4S,6R,9S,10S,11S)-6-methyl-9-[(2R)-6-methylhept-5-en-2-yl]-5,12-dioxatricyclo[8.3.0.04,6]tridec-1-en-11-ol |
|---|---|
| PubChem CID | 163188190 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (4S,6R,9S,10S,11S)-6-methyl-9-[(2R)-6-methylhept-5-en-2-yl]-5,12-dioxatricyclo[8.3.0.04,6]tridec-1-en-11-ol |
| SMILES | CC(C)=CCC[C@@H](C)[C@@H]1CC[C@@]2(C)O[C@H]2CC=C2CO[C@H](O)[C@H]21 |
| InChI | InChI=1S/C20H32O3/c1-13(2)6-5-7-14(3)16-10-11-20(4)17(23-20)9-8-15-12-22-19(21)18(15)16/h6,8,14,16-19,21H,5,7,9-12H2,1-4H3/t14-,16+,17+,18-,19+,20-/m1/s1 |
| InChIKey | KNLLXERQHPCIRN-CLTLGLDDSA-N |
| XLogP | 4.22 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|