C15H16O3 — CID 163188376
(2S,3S)-2-hydroxy-3-(3-methylbut-2-enyl)-2,3-dihydronaphthalene-1,4-dione (PubChem CID 163188376) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is (2S,3S)-2-hydroxy-3-(3-methylbut-2-enyl)-2,3-dihydronaphthalene-1,4-dione.
| Compound Name | (2S,3S)-2-hydroxy-3-(3-methylbut-2-enyl)-2,3-dihydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 163188376 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (2S,3S)-2-hydroxy-3-(3-methylbut-2-enyl)-2,3-dihydronaphthalene-1,4-dione |
| SMILES | CC(C)=CC[C@@H]1C(=O)c2ccccc2C(=O)[C@H]1O |
| InChI | InChI=1S/C15H16O3/c1-9(2)7-8-12-13(16)10-5-3-4-6-11(10)14(17)15(12)18/h3-7,12,15,18H,8H2,1-2H3/t12-,15+/m1/s1 |
| InChIKey | SIUGQQMOYSVTAT-DOMZBBRYSA-N |
| XLogP | 2.40 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|