C20H29N3O4 — CID 163188467
[(2R,7R,9R,9aS)-9-(hydroxymethyl)-7-[(2R)-6-oxopiperidin-2-yl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl] 1H-pyrrole-2-carboxylate (PubChem CID 163188467) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is [(2R,7R,9R,9aS)-9-(hydroxymethyl)-7-[(2R)-6-oxopiperidin-2-yl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl] 1H-pyrrole-2-carboxylate.
| Compound Name | [(2R,7R,9R,9aS)-9-(hydroxymethyl)-7-[(2R)-6-oxopiperidin-2-yl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl] 1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 163188467 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | [(2R,7R,9R,9aS)-9-(hydroxymethyl)-7-[(2R)-6-oxopiperidin-2-yl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl] 1H-pyrrole-2-carboxylate |
| SMILES | O=C1CCC[C@H]([C@@H]2C[C@@H](CO)[C@@H]3C[C@H](OC(=O)c4ccc[nH]4)CCN3C2)N1 |
| InChI | InChI=1S/C20H29N3O4/c24-12-14-9-13(16-3-1-5-19(25)22-16)11-23-8-6-15(10-18(14)23)27-20(26)17-4-2-7-21-17/h2,4,7,13-16,18,21,24H,1,3,5-6,8-12H2,(H,22,25)/t13-,14+,15-,16-,18+/m1/s1 |
| InChIKey | NNVWKIHRHLCZEU-DXWTWGPWSA-N |
| XLogP | 1.30 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |