About (2R)-tetradeca-3,5-dien-2-amine
(2R)-tetradeca-3,5-dien-2-amine (PubChem CID 163188609) has the molecular formula C14H27N
and a molecular weight of 209.38 g/mol. Its IUPAC name is (2R)-tetradeca-3,5-dien-2-amine.
Molecular Properties
| Compound Name | (2R)-tetradeca-3,5-dien-2-amine |
| PubChem CID | 163188609 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | (2R)-tetradeca-3,5-dien-2-amine |
| SMILES | CCCCCCCCC=CC=C[C@@H](C)N |
| InChI | InChI=1S/C14H27N/c1-3-4-5-6-7-8-9-10-11-12-13-14(2)15/h10-14H,3-9,15H2,1-2H3/t14-/m1/s1 |
| InChIKey | WCUPLXASCCDKJN-CQSZACIVSA-N |
| XLogP | 4.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-tetradeca-3,5-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-tetradeca-3,5-dien-2-amine?
The IUPAC name of (2R)-tetradeca-3,5-dien-2-amine (CID 163188609) is (2R)-tetradeca-3,5-dien-2-amine.
What is the SMILES notation for (2R)-tetradeca-3,5-dien-2-amine?
The canonical SMILES for (2R)-tetradeca-3,5-dien-2-amine is CCCCCCCCC=CC=C[C@@H](C)N.
What is the InChIKey of (2R)-tetradeca-3,5-dien-2-amine?
The InChIKey is WCUPLXASCCDKJN-CQSZACIVSA-N. The full InChI is InChI=1S/C14H27N/c1-3-4-5-6-7-8-9-10-11-12-13-14(2)15/h10-14H,3-9,15H2,1-2H3/t14-/m1/s1.
What are the key properties of (2R)-tetradeca-3,5-dien-2-amine?
(2R)-tetradeca-3,5-dien-2-amine has a molecular weight of 209.38 g/mol, XLogP of 4.20, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-tetradeca-3,5-dien-2-amine is sourced from PubChem (CID 163188609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).