About [2-[(2R,3R)-3-methyloxiran-2-yl]-4-(2-methylpropanoyloxy)phenyl] (Z)-2-methylbut-2-enoate
[2-[(2R,3R)-3-methyloxiran-2-yl]-4-(2-methylpropanoyloxy)phenyl] (Z)-2-methylbut-2-enoate (PubChem CID 163188798) has the molecular formula C18H22O5
and a molecular weight of 318.37 g/mol. Its IUPAC name is [2-[(2R,3R)-3-methyloxiran-2-yl]-4-(2-methylpropanoyloxy)phenyl] (Z)-2-methylbut-2-enoate.
Molecular Properties
| Compound Name | [2-[(2R,3R)-3-methyloxiran-2-yl]-4-(2-methylpropanoyloxy)phenyl] (Z)-2-methylbut-2-enoate |
| PubChem CID | 163188798 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | [2-[(2R,3R)-3-methyloxiran-2-yl]-4-(2-methylpropanoyloxy)phenyl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)Oc1ccc(OC(=O)C(C)C)cc1[C@H]1O[C@@H]1C |
| InChI | InChI=1S/C18H22O5/c1-6-11(4)18(20)23-15-8-7-13(22-17(19)10(2)3)9-14(15)16-12(5)21-16/h6-10,12,16H,1-5H3/b11-6-/t12-,16+/m1/s1 |
| InChIKey | FOVBSXKQAYLJKF-CLYSGXADSA-N |
| XLogP | 3.58 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [2-[(2R,3R)-3-methyloxiran-2-yl]-4-(2-methylpropanoyloxy)phenyl] (Z)-2-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2R,3R)-3-methyloxiran-2-yl]-4-(2-methylpropanoyloxy)phenyl] (Z)-2-methylbut-2-enoate?
The IUPAC name of [2-[(2R,3R)-3-methyloxiran-2-yl]-4-(2-methylpropanoyloxy)phenyl] (Z)-2-methylbut-2-enoate (CID 163188798) is [2-[(2R,3R)-3-methyloxiran-2-yl]-4-(2-methylpropanoyloxy)phenyl] (Z)-2-methylbut-2-enoate.
What is the SMILES notation for [2-[(2R,3R)-3-methyloxiran-2-yl]-4-(2-methylpropanoyloxy)phenyl] (Z)-2-methylbut-2-enoate?
The canonical SMILES for [2-[(2R,3R)-3-methyloxiran-2-yl]-4-(2-methylpropanoyloxy)phenyl] (Z)-2-methylbut-2-enoate is C/C=C(/C)C(=O)Oc1ccc(OC(=O)C(C)C)cc1[C@H]1O[C@@H]1C.
What is the InChIKey of [2-[(2R,3R)-3-methyloxiran-2-yl]-4-(2-methylpropanoyloxy)phenyl] (Z)-2-methylbut-2-enoate?
The InChIKey is FOVBSXKQAYLJKF-CLYSGXADSA-N. The full InChI is InChI=1S/C18H22O5/c1-6-11(4)18(20)23-15-8-7-13(22-17(19)10(2)3)9-14(15)16-12(5)21-16/h6-10,12,16H,1-5H3/b11-6-/t12-,16+/m1/s1.
What are the key properties of [2-[(2R,3R)-3-methyloxiran-2-yl]-4-(2-methylpropanoyloxy)phenyl] (Z)-2-methylbut-2-enoate?
[2-[(2R,3R)-3-methyloxiran-2-yl]-4-(2-methylpropanoyloxy)phenyl] (Z)-2-methylbut-2-enoate has a molecular weight of 318.37 g/mol, XLogP of 3.58, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2R,3R)-3-methyloxiran-2-yl]-4-(2-methylpropanoyloxy)phenyl] (Z)-2-methylbut-2-enoate is sourced from PubChem (CID 163188798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).