C21H24N2O3 — CID 163188953
methyl (15R,18R,19R,20R)-18-hydroxy-11,12,14,15,16,17,18,19,20,21-decahydroyohimban-19-carboxylate (PubChem CID 163188953) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is methyl (15R,18R,19R,20R)-18-hydroxy-11,12,14,15,16,17,18,19,20,21-decahydroyohimban-19-carboxylate.
| Compound Name | methyl (15R,18R,19R,20R)-18-hydroxy-11,12,14,15,16,17,18,19,20,21-decahydroyohimban-19-carboxylate |
|---|---|
| PubChem CID | 163188953 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | methyl (15R,18R,19R,20R)-18-hydroxy-11,12,14,15,16,17,18,19,20,21-decahydroyohimban-19-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2CC3=C4N=c5ccccc5=C4CCN3C[C@@H]2CC[C@H]1O |
| InChI | InChI=1S/C21H24N2O3/c1-26-21(25)19-15-10-17-20-14(13-4-2-3-5-16(13)22-20)8-9-23(17)11-12(15)6-7-18(19)24/h2-5,12,15,18-19,24H,6-11H2,1H3/t12-,15+,18+,19+/m0/s1 |
| InChIKey | ABXHGHKISIEEEJ-GGCQVYRISA-N |
| XLogP | 0.97 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |