C17H24O5 — CID 163189064
[(6Z,9S,10S,11aR)-9-hydroxy-3,6,10-trimethyl-2-oxo-4,5,8,9,11,11a-hexahydrocyclodeca[b]furan-10-yl] acetate (PubChem CID 163189064) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is [(6Z,9S,10S,11aR)-9-hydroxy-3,6,10-trimethyl-2-oxo-4,5,8,9,11,11a-hexahydrocyclodeca[b]furan-10-yl] acetate.
| Compound Name | [(6Z,9S,10S,11aR)-9-hydroxy-3,6,10-trimethyl-2-oxo-4,5,8,9,11,11a-hexahydrocyclodeca[b]furan-10-yl] acetate |
|---|---|
| PubChem CID | 163189064 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | [(6Z,9S,10S,11aR)-9-hydroxy-3,6,10-trimethyl-2-oxo-4,5,8,9,11,11a-hexahydrocyclodeca[b]furan-10-yl] acetate |
| SMILES | CC(=O)O[C@@]1(C)C[C@H]2OC(=O)C(C)=C2CC/C(C)=C\C[C@@H]1O |
| InChI | InChI=1S/C17H24O5/c1-10-5-7-13-11(2)16(20)21-14(13)9-17(4,22-12(3)18)15(19)8-6-10/h6,14-15,19H,5,7-9H2,1-4H3/b10-6-/t14-,15+,17+/m1/s1 |
| InChIKey | OVGYDOMDHGXNRX-DFWYTYFRSA-N |
| XLogP | 2.43 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|