C17H20O — CID 163189087
(2R,3R)-2-hex-5-enyl-3-[(1E,7E)-nona-1,7-dien-3,5-diynyl]oxirane (PubChem CID 163189087) has the molecular formula C17H20O and a molecular weight of 240.35 g/mol. Its IUPAC name is (2R,3R)-2-hex-5-enyl-3-[(1E,7E)-nona-1,7-dien-3,5-diynyl]oxirane.
| Compound Name | (2R,3R)-2-hex-5-enyl-3-[(1E,7E)-nona-1,7-dien-3,5-diynyl]oxirane |
|---|---|
| PubChem CID | 163189087 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | (2R,3R)-2-hex-5-enyl-3-[(1E,7E)-nona-1,7-dien-3,5-diynyl]oxirane |
| SMILES | C=CCCCC[C@H]1O[C@@H]1/C=C/C#CC#C/C=C/C |
| InChI | InChI=1S/C17H20O/c1-3-5-7-9-10-11-13-15-17-16(18-17)14-12-8-6-4-2/h3-5,13,15-17H,2,6,8,12,14H2,1H3/b5-3+,15-13+/t16-,17-/m1/s1 |
| InChIKey | GRIRFVRSWUHHTQ-YZDWNGRYSA-N |
| XLogP | 3.64 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|