C23H30O6 — CID 163189192
methyl (5S,6E,14E,15aS)-5-acetyloxy-3,6,14-trimethyl-2-oxo-5,8,9,12,13,15a-hexahydro-4H-cyclotetradeca[b]furan-10-carboxylate (PubChem CID 163189192) has the molecular formula C23H30O6 and a molecular weight of 402.49 g/mol. Its IUPAC name is methyl (5S,6E,14E,15aS)-5-acetyloxy-3,6,14-trimethyl-2-oxo-5,8,9,12,13,15a-hexahydro-4H-cyclotetradeca[b]furan-10-carboxylate.
| Compound Name | methyl (5S,6E,14E,15aS)-5-acetyloxy-3,6,14-trimethyl-2-oxo-5,8,9,12,13,15a-hexahydro-4H-cyclotetradeca[b]furan-10-carboxylate |
|---|---|
| PubChem CID | 163189192 |
| Molecular Formula | C23H30O6 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | methyl (5S,6E,14E,15aS)-5-acetyloxy-3,6,14-trimethyl-2-oxo-5,8,9,12,13,15a-hexahydro-4H-cyclotetradeca[b]furan-10-carboxylate |
| SMILES | COC(=O)C1=CCC/C(C)=C/[C@@H]2OC(=O)C(C)=C2C[C@H](OC(C)=O)/C(C)=C/CC1 |
| InChI | InChI=1S/C23H30O6/c1-14-8-6-10-18(23(26)27-5)11-7-9-15(2)20(28-17(4)24)13-19-16(3)22(25)29-21(19)12-14/h9-10,12,20-21H,6-8,11,13H2,1-5H3/b14-12+,15-9+,18-10?/t20-,21-/m0/s1 |
| InChIKey | JQCWXJKSJTVECI-OHMPZEOUSA-N |
| XLogP | 4.12 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|