C10H15NO — CID 163189245
(2S)-2-ethenyl-2,6-dimethyl-3,4-dihydro-1H-azepin-7-one (PubChem CID 163189245) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (2S)-2-ethenyl-2,6-dimethyl-3,4-dihydro-1H-azepin-7-one.
| Compound Name | (2S)-2-ethenyl-2,6-dimethyl-3,4-dihydro-1H-azepin-7-one |
|---|---|
| PubChem CID | 163189245 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (2S)-2-ethenyl-2,6-dimethyl-3,4-dihydro-1H-azepin-7-one |
| SMILES | C=C[C@]1(C)CCC=C(C)C(=O)N1 |
| InChI | InChI=1S/C10H15NO/c1-4-10(3)7-5-6-8(2)9(12)11-10/h4,6H,1,5,7H2,2-3H3,(H,11,12)/t10-/m1/s1 |
| InChIKey | SVOHYKNFWLSAJV-SNVBAGLBSA-N |
| XLogP | 1.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|