C21H24N2O3 — CID 163189766
1-[(1R,11S,12E,17S)-12-ethylidene-10-(hydroxymethyl)-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraen-8-yl]-2-hydroxyethanone (PubChem CID 163189766) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 1-[(1R,11S,12E,17S)-12-ethylidene-10-(hydroxymethyl)-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraen-8-yl]-2-hydroxyethanone.
| Compound Name | 1-[(1R,11S,12E,17S)-12-ethylidene-10-(hydroxymethyl)-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraen-8-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 163189766 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 1-[(1R,11S,12E,17S)-12-ethylidene-10-(hydroxymethyl)-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraen-8-yl]-2-hydroxyethanone |
| SMILES | C/C=C1/CN2CC[C@]34C(=C(CO)[C@H]1C[C@H]23)N(C(=O)CO)c1ccccc14 |
| InChI | InChI=1S/C21H24N2O3/c1-2-13-10-22-8-7-21-16-5-3-4-6-17(16)23(19(26)12-25)20(21)15(11-24)14(13)9-18(21)22/h2-6,14,18,24-25H,7-12H2,1H3/b13-2-/t14-,18-,21+/m0/s1 |
| InChIKey | HGXCDAICSCDJCX-FWWDEBHXSA-N |
| XLogP | 1.56 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|