C18H26O10 — CID 163190144
(2S,3R,4S,5S,6R)-6-(hydroxymethyl)-2-phenylmethoxy-2-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxane-3,4,5-triol (PubChem CID 163190144) has the molecular formula C18H26O10 and a molecular weight of 402.40 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-6-(hydroxymethyl)-2-phenylmethoxy-2-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-6-(hydroxymethyl)-2-phenylmethoxy-2-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 163190144 |
| Molecular Formula | C18H26O10 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | (2S,3R,4S,5S,6R)-6-(hydroxymethyl)-2-phenylmethoxy-2-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@](OCc2ccccc2)([C@@H]2OC[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H26O10/c19-6-11-13(22)14(23)16(25)18(28-11,27-7-9-4-2-1-3-5-9)17-15(24)12(21)10(20)8-26-17/h1-5,10-17,19-25H,6-8H2/t10-,11-,12+,13-,14+,15-,16-,17-,18+/m1/s1 |
| InChIKey | CKZPWPRHWOEACS-PDBDJCPPSA-N |
| XLogP | -3.15 |
| TPSA | 169.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |