C35H32O16 — CID 163190184
[3-[(2S,3R,4S,5S,6R)-3-acetyloxy-6-(acetyloxymethyl)-4,5-dihydroxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 163190184) has the molecular formula C35H32O16 and a molecular weight of 708.63 g/mol. Its IUPAC name is [3-[(2S,3R,4S,5S,6R)-3-acetyloxy-6-(acetyloxymethyl)-4,5-dihydroxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | [3-[(2S,3R,4S,5S,6R)-3-acetyloxy-6-(acetyloxymethyl)-4,5-dihydroxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 163190184 |
| Molecular Formula | C35H32O16 |
| Molecular Weight | 708.63 g/mol |
| Exact Mass | 708.17 |
| IUPAC Name | [3-[(2S,3R,4S,5S,6R)-3-acetyloxy-6-(acetyloxymethyl)-4,5-dihydroxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)Oc2cc(O)c3c(=O)c(O[C@@H]4O[C@H](COC(C)=O)[C@@H](O)[C@H](O)[C@H]4OC(C)=O)c(-c4ccc(O)cc4)oc3c2)ccc1O |
| InChI | InChI=1S/C35H32O16/c1-16(36)46-15-26-29(42)31(44)34(47-17(2)37)35(50-26)51-33-30(43)28-23(40)13-21(14-25(28)49-32(33)19-6-8-20(38)9-7-19)48-27(41)11-5-18-4-10-22(39)24(12-18)45-3/h4-14,26,29,31,34-35,38-40,42,44H,15H2,1-3H3/b11-5+/t26-,29-,31+,34-,35+/m1/s1 |
| InChIKey | CNRUFHBCTLNEKQ-SFMWUBETSA-N |
| XLogP | 2.52 |
| TPSA | 237.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.63 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|