C14H24O8 — CID 163190233
(4R)-5,5-dimethyl-4-[2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]oxolan-2-one (PubChem CID 163190233) has the molecular formula C14H24O8 and a molecular weight of 320.34 g/mol. Its IUPAC name is (4R)-5,5-dimethyl-4-[2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]oxolan-2-one.
| Compound Name | (4R)-5,5-dimethyl-4-[2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]oxolan-2-one |
|---|---|
| PubChem CID | 163190233 |
| Molecular Formula | C14H24O8 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | (4R)-5,5-dimethyl-4-[2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]oxolan-2-one |
| SMILES | CC1(C)OC(=O)C[C@H]1CCO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H24O8/c1-14(2)7(5-9(16)22-14)3-4-20-13-12(19)11(18)10(17)8(6-15)21-13/h7-8,10-13,15,17-19H,3-6H2,1-2H3/t7-,8-,10-,11+,12-,13-/m1/s1 |
| InChIKey | FKEVUODPBVBGOT-ITBWZIIFSA-N |
| XLogP | -1.47 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |