C27H36O5 — CID 163191045
[(3R,3aS,4S,8R,8aS)-3-hydroxy-6,8a-dimethyl-8-[(Z)-2-methylbut-2-enoyl]oxy-3-propan-2-yl-1,2,3a,4,5,8-hexahydroazulen-4-yl] benzoate (PubChem CID 163191045) has the molecular formula C27H36O5 and a molecular weight of 440.58 g/mol. Its IUPAC name is [(3R,3aS,4S,8R,8aS)-3-hydroxy-6,8a-dimethyl-8-[(Z)-2-methylbut-2-enoyl]oxy-3-propan-2-yl-1,2,3a,4,5,8-hexahydroazulen-4-yl] benzoate.
| Compound Name | [(3R,3aS,4S,8R,8aS)-3-hydroxy-6,8a-dimethyl-8-[(Z)-2-methylbut-2-enoyl]oxy-3-propan-2-yl-1,2,3a,4,5,8-hexahydroazulen-4-yl] benzoate |
|---|---|
| PubChem CID | 163191045 |
| Molecular Formula | C27H36O5 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | [(3R,3aS,4S,8R,8aS)-3-hydroxy-6,8a-dimethyl-8-[(Z)-2-methylbut-2-enoyl]oxy-3-propan-2-yl-1,2,3a,4,5,8-hexahydroazulen-4-yl] benzoate |
| SMILES | C/C=C(/C)C(=O)O[C@@H]1C=C(C)C[C@H](OC(=O)c2ccccc2)[C@@H]2[C@]1(C)CC[C@@]2(O)C(C)C |
| InChI | InChI=1S/C27H36O5/c1-7-19(5)24(28)32-22-16-18(4)15-21(31-25(29)20-11-9-8-10-12-20)23-26(22,6)13-14-27(23,30)17(2)3/h7-12,16-17,21-23,30H,13-15H2,1-6H3/b19-7-/t21-,22+,23+,26+,27+/m0/s1 |
| InChIKey | IOZNPOAQGRGQHI-XTXQZMPJSA-N |
| XLogP | 5.24 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|