C24H38O8S — CID 163191088
(4R,6R,12S)-6-hydroxy-4-[[(4R,6R,12S)-6-hydroxy-12-methyl-2,5-dioxo-oxacyclododec-4-yl]sulfanyl]-12-methyl-oxacyclododecane-2,5-dione (PubChem CID 163191088) has the molecular formula C24H38O8S and a molecular weight of 486.63 g/mol. Its IUPAC name is (4R,6R,12S)-6-hydroxy-4-[[(4R,6R,12S)-6-hydroxy-12-methyl-2,5-dioxo-oxacyclododec-4-yl]sulfanyl]-12-methyl-oxacyclododecane-2,5-dione.
| Compound Name | (4R,6R,12S)-6-hydroxy-4-[[(4R,6R,12S)-6-hydroxy-12-methyl-2,5-dioxo-oxacyclododec-4-yl]sulfanyl]-12-methyl-oxacyclododecane-2,5-dione |
|---|---|
| PubChem CID | 163191088 |
| Molecular Formula | C24H38O8S |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | (4R,6R,12S)-6-hydroxy-4-[[(4R,6R,12S)-6-hydroxy-12-methyl-2,5-dioxo-oxacyclododec-4-yl]sulfanyl]-12-methyl-oxacyclododecane-2,5-dione |
| SMILES | C[C@H]1CCCCC[C@@H](O)C(=O)[C@H](S[C@@H]2CC(=O)O[C@@H](C)CCCCC[C@@H](O)C2=O)CC(=O)O1 |
| InChI | InChI=1S/C24H38O8S/c1-15-9-5-3-7-11-17(25)23(29)19(13-21(27)31-15)33-20-14-22(28)32-16(2)10-6-4-8-12-18(26)24(20)30/h15-20,25-26H,3-14H2,1-2H3/t15-,16-,17+,18+,19+,20+/m0/s1 |
| InChIKey | NUPJXSWNOKBNII-VTYCOLDWSA-N |
| XLogP | 2.89 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |