C16H24O3 — CID 163191124
(1R,2R,5S,7R,10S)-10-hydroxy-2,5,6,6-tetramethyltricyclo[5.3.1.01,5]undec-8-ene-8-carboxylic acid (PubChem CID 163191124) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is (1R,2R,5S,7R,10S)-10-hydroxy-2,5,6,6-tetramethyltricyclo[5.3.1.01,5]undec-8-ene-8-carboxylic acid.
| Compound Name | (1R,2R,5S,7R,10S)-10-hydroxy-2,5,6,6-tetramethyltricyclo[5.3.1.01,5]undec-8-ene-8-carboxylic acid |
|---|---|
| PubChem CID | 163191124 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (1R,2R,5S,7R,10S)-10-hydroxy-2,5,6,6-tetramethyltricyclo[5.3.1.01,5]undec-8-ene-8-carboxylic acid |
| SMILES | C[C@@H]1CC[C@@]2(C)C(C)(C)[C@H]3C[C@@]12[C@@H](O)C=C3C(=O)O |
| InChI | InChI=1S/C16H24O3/c1-9-5-6-15(4)14(2,3)11-8-16(9,15)12(17)7-10(11)13(18)19/h7,9,11-12,17H,5-6,8H2,1-4H3,(H,18,19)/t9-,11+,12+,15+,16+/m1/s1 |
| InChIKey | OHVOURKKOMEQPG-CHIYKUSMSA-N |
| XLogP | 2.84 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |