C17H25Cl6N3OS — CID 163191189
(3R)-4,4,4-trichloro-N,3-dimethyl-N-[(2R,4R)-5,5,5-trichloro-4-methyl-1-[[(1R)-1-(1,3-thiazol-2-yl)ethyl]amino]pentan-2-yl]butanamide (PubChem CID 163191189) has the molecular formula C17H25Cl6N3OS and a molecular weight of 532.19 g/mol. Its IUPAC name is (3R)-4,4,4-trichloro-N,3-dimethyl-N-[(2R,4R)-5,5,5-trichloro-4-methyl-1-[[(1R)-1-(1,3-thiazol-2-yl)ethyl]amino]pentan-2-yl]butanamide.
| Compound Name | (3R)-4,4,4-trichloro-N,3-dimethyl-N-[(2R,4R)-5,5,5-trichloro-4-methyl-1-[[(1R)-1-(1,3-thiazol-2-yl)ethyl]amino]pentan-2-yl]butanamide |
|---|---|
| PubChem CID | 163191189 |
| Molecular Formula | C17H25Cl6N3OS |
| Molecular Weight | 532.19 g/mol |
| Exact Mass | 528.98 |
| IUPAC Name | (3R)-4,4,4-trichloro-N,3-dimethyl-N-[(2R,4R)-5,5,5-trichloro-4-methyl-1-[[(1R)-1-(1,3-thiazol-2-yl)ethyl]amino]pentan-2-yl]butanamide |
| SMILES | C[C@H](CC(=O)N(C)[C@@H](CN[C@H](C)c1nccs1)C[C@@H](C)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H25Cl6N3OS/c1-10(16(18,19)20)7-13(9-25-12(3)15-24-5-6-28-15)26(4)14(27)8-11(2)17(21,22)23/h5-6,10-13,25H,7-9H2,1-4H3/t10-,11-,12-,13-/m1/s1 |
| InChIKey | YHEHHHIOCICHNO-FDYHWXHSSA-N |
| XLogP | 6.41 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.19 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|