C22H30O4 — CID 163191431
[(5E)-5-[(4aS,11aR)-7-methyl-11-methylidene-3-oxo-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-4-ylidene]-2-methylpent-1-en-3-yl] acetate (PubChem CID 163191431) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is [(5E)-5-[(4aS,11aR)-7-methyl-11-methylidene-3-oxo-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-4-ylidene]-2-methylpent-1-en-3-yl] acetate.
| Compound Name | [(5E)-5-[(4aS,11aR)-7-methyl-11-methylidene-3-oxo-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-4-ylidene]-2-methylpent-1-en-3-yl] acetate |
|---|---|
| PubChem CID | 163191431 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | [(5E)-5-[(4aS,11aR)-7-methyl-11-methylidene-3-oxo-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-4-ylidene]-2-methylpent-1-en-3-yl] acetate |
| SMILES | C=C(C)C(C/C=C1/C(=O)OC[C@H]2C(=C)CCC=C(C)CC[C@H]12)OC(C)=O |
| InChI | InChI=1S/C22H30O4/c1-14(2)21(26-17(5)23)12-11-19-18-10-9-15(3)7-6-8-16(4)20(18)13-25-22(19)24/h7,11,18,20-21H,1,4,6,8-10,12-13H2,2-3,5H3/b15-7?,19-11+/t18-,20+,21?/m1/s1 |
| InChIKey | ZQNYFJWSDUYQGB-UPHAJUOQSA-N |
| XLogP | 4.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|