C25H42N2 — CID 163191573
(1R,2E,19S,20R,25S)-13,17-diazatricyclo[17.8.0.020,25]heptacosa-2,9,26-triene (PubChem CID 163191573) has the molecular formula C25H42N2 and a molecular weight of 370.63 g/mol. Its IUPAC name is (1R,2E,19S,20R,25S)-13,17-diazatricyclo[17.8.0.020,25]heptacosa-2,9,26-triene.
| Compound Name | (1R,2E,19S,20R,25S)-13,17-diazatricyclo[17.8.0.020,25]heptacosa-2,9,26-triene |
|---|---|
| PubChem CID | 163191573 |
| Molecular Formula | C25H42N2 |
| Molecular Weight | 370.63 g/mol |
| Exact Mass | 370.33 |
| IUPAC Name | (1R,2E,19S,20R,25S)-13,17-diazatricyclo[17.8.0.020,25]heptacosa-2,9,26-triene |
| SMILES | C1=CCCNCCCNC[C@H]2[C@@H]3CCCC[C@H]3C=C[C@H]2/C=C/CCCCC1 |
| InChI | InChI=1S/C25H42N2/c1-2-4-6-8-13-23-17-16-22-14-9-10-15-24(22)25(23)21-27-20-12-19-26-18-11-7-5-3-1/h5,7-8,13,16-17,22-27H,1-4,6,9-12,14-15,18-21H2/b7-5?,13-8+/t22-,23+,24+,25+/m0/s1 |
| InChIKey | YMEPYIIXGBBSMO-IAYKKJIOSA-N |
| XLogP | 5.63 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.63 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|