C15H21Br2Cl — CID 163191762
(6S)-4,10-dibromo-9-chloro-1,5,5,9-tetramethylspiro[5.5]undeca-1,3-diene (PubChem CID 163191762) has the molecular formula C15H21Br2Cl and a molecular weight of 396.59 g/mol. Its IUPAC name is (6S)-4,10-dibromo-9-chloro-1,5,5,9-tetramethylspiro[5.5]undeca-1,3-diene.
| Compound Name | (6S)-4,10-dibromo-9-chloro-1,5,5,9-tetramethylspiro[5.5]undeca-1,3-diene |
|---|---|
| PubChem CID | 163191762 |
| Molecular Formula | C15H21Br2Cl |
| Molecular Weight | 396.59 g/mol |
| Exact Mass | 393.97 |
| IUPAC Name | (6S)-4,10-dibromo-9-chloro-1,5,5,9-tetramethylspiro[5.5]undeca-1,3-diene |
| SMILES | CC1=CC=C(Br)C(C)(C)[C@]12CCC(C)(Cl)C(Br)C2 |
| InChI | InChI=1S/C15H21Br2Cl/c1-10-5-6-11(16)13(2,3)15(10)8-7-14(4,18)12(17)9-15/h5-6,12H,7-9H2,1-4H3/t12?,14?,15-/m0/s1 |
| InChIKey | PHHUSFCHCZLGNG-ZALBZXLWSA-N |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.59 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|