C15H24O3 — CID 163192504
2-(1,2,4a-trimethyl-5-oxo-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)acetic acid (PubChem CID 163192504) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is 2-(1,2,4a-trimethyl-5-oxo-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)acetic acid.
| Compound Name | 2-(1,2,4a-trimethyl-5-oxo-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)acetic acid |
|---|---|
| PubChem CID | 163192504 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 2-(1,2,4a-trimethyl-5-oxo-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)acetic acid |
| SMILES | CC1CCC2(C)C(=O)CCCC2C1(C)CC(=O)O |
| InChI | InChI=1S/C15H24O3/c1-10-7-8-14(2)11(5-4-6-12(14)16)15(10,3)9-13(17)18/h10-11H,4-9H2,1-3H3,(H,17,18) |
| InChIKey | XSULRTJPELTEQJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |