3-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)propanoic acid

C12H18O2 — CID 163192527

IUPAC3-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)propanoic acid
SMILESCC(C)C1=CC=C(CCC(=O)O)CC1
InChIInChI=1S/C12H18O2/c1-9(2)11-6-3-10(4-7-11)5-8-12(13)14/h3,6,9H,4-5,7-8H2,1-2H3,(H,13,14)
InChIKeyGFZVHMRCXBMQFI-UHFFFAOYSA-N
MW194.27 g/mol
LogP3.15
Rot. Bonds4

About 3-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)propanoic acid

3-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)propanoic acid (PubChem CID 163192527) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 3-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)propanoic acid.

Molecular Properties

Compound Name3-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)propanoic acid
PubChem CID163192527
Molecular FormulaC12H18O2
Molecular Weight194.27 g/mol
Exact Mass194.13
IUPAC Name3-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)propanoic acid
SMILESCC(C)C1=CC=C(CCC(=O)O)CC1
InChIInChI=1S/C12H18O2/c1-9(2)11-6-3-10(4-7-11)5-8-12(13)14/h3,6,9H,4-5,7-8H2,1-2H3,(H,13,14)
InChIKeyGFZVHMRCXBMQFI-UHFFFAOYSA-N
XLogP3.15
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.27
LogP ≤ 53.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 3-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)propanoic acid?
The IUPAC name of 3-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)propanoic acid (CID 163192527) is 3-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)propanoic acid.
What is the SMILES notation for 3-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)propanoic acid?
The canonical SMILES for 3-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)propanoic acid is CC(C)C1=CC=C(CCC(=O)O)CC1.
What is the InChIKey of 3-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)propanoic acid?
The InChIKey is GFZVHMRCXBMQFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2/c1-9(2)11-6-3-10(4-7-11)5-8-12(13)14/h3,6,9H,4-5,7-8H2,1-2H3,(H,13,14).
What are the key properties of 3-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)propanoic acid?
3-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)propanoic acid has a molecular weight of 194.27 g/mol, XLogP of 3.15, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)propanoic acid is sourced from PubChem (CID 163192527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).