C8H12O3 — CID 163192686
4-hydroxy-4-(2-hydroxyethyl)cyclohex-2-en-1-one (PubChem CID 163192686) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is 4-hydroxy-4-(2-hydroxyethyl)cyclohex-2-en-1-one.
| Compound Name | 4-hydroxy-4-(2-hydroxyethyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 163192686 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 4-hydroxy-4-(2-hydroxyethyl)cyclohex-2-en-1-one |
| SMILES | O=C1C=CC(O)(CCO)CC1 |
| InChI | InChI=1S/C8H12O3/c9-6-5-8(11)3-1-7(10)2-4-8/h1,3,9,11H,2,4-6H2 |
| InChIKey | JGWLQWUVJUFKHJ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |