C17H24N+ — CID 163192779
2-(5-methylhepta-1,3,5-trienyl)-1,1a,2,4,5,6,7,7b-octahydrocyclopropa[a]indolizin-3-ium (PubChem CID 163192779) has the molecular formula C17H24N+ and a molecular weight of 242.39 g/mol. Its IUPAC name is 2-(5-methylhepta-1,3,5-trienyl)-1,1a,2,4,5,6,7,7b-octahydrocyclopropa[a]indolizin-3-ium.
| Compound Name | 2-(5-methylhepta-1,3,5-trienyl)-1,1a,2,4,5,6,7,7b-octahydrocyclopropa[a]indolizin-3-ium |
|---|---|
| PubChem CID | 163192779 |
| Molecular Formula | C17H24N+ |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 2-(5-methylhepta-1,3,5-trienyl)-1,1a,2,4,5,6,7,7b-octahydrocyclopropa[a]indolizin-3-ium |
| SMILES | CC=C(C)C=CC=CC1C2CC2C2=[N+]1CCCC2 |
| InChI | InChI=1S/C17H24N/c1-3-13(2)8-4-5-9-16-14-12-15(14)17-10-6-7-11-18(16)17/h3-5,8-9,14-16H,6-7,10-12H2,1-2H3/q+1 |
| InChIKey | ZGGASQUTZHTTQR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|