About 3-(3,7-dimethyl-7-bicyclo[4.1.0]hept-2-enyl)propanamide
3-(3,7-dimethyl-7-bicyclo[4.1.0]hept-2-enyl)propanamide (PubChem CID 163192795) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is 3-(3,7-dimethyl-7-bicyclo[4.1.0]hept-2-enyl)propanamide.
Molecular Properties
| Compound Name | 3-(3,7-dimethyl-7-bicyclo[4.1.0]hept-2-enyl)propanamide |
| PubChem CID | 163192795 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 3-(3,7-dimethyl-7-bicyclo[4.1.0]hept-2-enyl)propanamide |
| SMILES | CC1=CC2C(CC1)C2(C)CCC(N)=O |
| InChI | InChI=1S/C12H19NO/c1-8-3-4-9-10(7-8)12(9,2)6-5-11(13)14/h7,9-10H,3-6H2,1-2H3,(H2,13,14) |
| InChIKey | PDAXPWKNBHXMKY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,7-dimethyl-7-bicyclo[4.1.0]hept-2-enyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,7-dimethyl-7-bicyclo[4.1.0]hept-2-enyl)propanamide?
The IUPAC name of 3-(3,7-dimethyl-7-bicyclo[4.1.0]hept-2-enyl)propanamide (CID 163192795) is 3-(3,7-dimethyl-7-bicyclo[4.1.0]hept-2-enyl)propanamide.
What is the SMILES notation for 3-(3,7-dimethyl-7-bicyclo[4.1.0]hept-2-enyl)propanamide?
The canonical SMILES for 3-(3,7-dimethyl-7-bicyclo[4.1.0]hept-2-enyl)propanamide is CC1=CC2C(CC1)C2(C)CCC(N)=O.
What is the InChIKey of 3-(3,7-dimethyl-7-bicyclo[4.1.0]hept-2-enyl)propanamide?
The InChIKey is PDAXPWKNBHXMKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO/c1-8-3-4-9-10(7-8)12(9,2)6-5-11(13)14/h7,9-10H,3-6H2,1-2H3,(H2,13,14).
What are the key properties of 3-(3,7-dimethyl-7-bicyclo[4.1.0]hept-2-enyl)propanamide?
3-(3,7-dimethyl-7-bicyclo[4.1.0]hept-2-enyl)propanamide has a molecular weight of 193.29 g/mol, XLogP of 2.24, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,7-dimethyl-7-bicyclo[4.1.0]hept-2-enyl)propanamide is sourced from PubChem (CID 163192795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).