C36H64O3Si2 — CID 163193075
trimethylsilyl (4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-trimethylsilyloxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate (PubChem CID 163193075) has the molecular formula C36H64O3Si2 and a molecular weight of 601.08 g/mol. Its IUPAC name is trimethylsilyl (4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-trimethylsilyloxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate.
| Compound Name | trimethylsilyl (4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-trimethylsilyloxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
|---|---|
| PubChem CID | 163193075 |
| Molecular Formula | C36H64O3Si2 |
| Molecular Weight | 601.08 g/mol |
| Exact Mass | 600.44 |
| IUPAC Name | trimethylsilyl (4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-trimethylsilyloxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
| SMILES | CC1(C)CC[C@]2(C(=O)O[Si](C)(C)C)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@H](O[Si](C)(C)C)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C36H64O3Si2/c1-31(2)20-22-36(30(37)39-41(11,12)13)23-21-34(6)25(26(36)24-31)14-15-28-33(5)18-17-29(38-40(8,9)10)32(3,4)27(33)16-19-35(28,34)7/h14,26-29H,15-24H2,1-13H3/t26-,27-,28+,29-,33-,34+,35+,36-/m0/s1 |
| InChIKey | GZXFTIBVEUGZSC-QZUHWTNASA-N |
| XLogP | 10.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.08 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|