C29H44O6 — CID 163193153
(1S,2S,4R,5S,10R,11S,14R,15R,18S)-5,10,14-trimethyl-15-[(1S)-1-[(2R,4R,5R,6S)-4,5,6-trihydroxy-4,5-dimethyloxan-2-yl]ethyl]-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadec-7-en-9-one (PubChem CID 163193153) has the molecular formula C29H44O6 and a molecular weight of 488.67 g/mol. Its IUPAC name is (1S,2S,4R,5S,10R,11S,14R,15R,18S)-5,10,14-trimethyl-15-[(1S)-1-[(2R,4R,5R,6S)-4,5,6-trihydroxy-4,5-dimethyloxan-2-yl]ethyl]-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadec-7-en-9-one.
| Compound Name | (1S,2S,4R,5S,10R,11S,14R,15R,18S)-5,10,14-trimethyl-15-[(1S)-1-[(2R,4R,5R,6S)-4,5,6-trihydroxy-4,5-dimethyloxan-2-yl]ethyl]-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadec-7-en-9-one |
|---|---|
| PubChem CID | 163193153 |
| Molecular Formula | C29H44O6 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.31 |
| IUPAC Name | (1S,2S,4R,5S,10R,11S,14R,15R,18S)-5,10,14-trimethyl-15-[(1S)-1-[(2R,4R,5R,6S)-4,5,6-trihydroxy-4,5-dimethyloxan-2-yl]ethyl]-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadec-7-en-9-one |
| SMILES | C[C@@H]([C@H]1CC[C@H]2[C@@H]3[C@@H]4O[C@@H]4[C@@]4(C)CC=CC(=O)[C@]4(C)[C@H]3CC[C@]12C)[C@H]1C[C@@](C)(O)[C@@](C)(O)[C@@H](O)O1 |
| InChI | InChI=1S/C29H44O6/c1-15(19-14-27(4,32)29(6,33)24(31)34-19)16-9-10-17-21-18(11-13-25(16,17)2)28(5)20(30)8-7-12-26(28,3)23-22(21)35-23/h7-8,15-19,21-24,31-33H,9-14H2,1-6H3/t15-,16+,17-,18-,19+,21-,22-,23-,24-,25+,26+,27+,28-,29-/m0/s1 |
| InChIKey | KPBVVXMQPMNEMP-HHWFDCDPSA-N |
| XLogP | 3.61 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|