About methyl 8-[(5R)-2-[(E,2R)-2-hydroxypent-3-enyl]-5-methoxy-3-oxocyclopenten-1-yl]octanoate
methyl 8-[(5R)-2-[(E,2R)-2-hydroxypent-3-enyl]-5-methoxy-3-oxocyclopenten-1-yl]octanoate (PubChem CID 163193295) has the molecular formula C20H32O5
and a molecular weight of 352.47 g/mol. Its IUPAC name is methyl 8-[(5R)-2-[(E,2R)-2-hydroxypent-3-enyl]-5-methoxy-3-oxocyclopenten-1-yl]octanoate.
Molecular Properties
| Compound Name | methyl 8-[(5R)-2-[(E,2R)-2-hydroxypent-3-enyl]-5-methoxy-3-oxocyclopenten-1-yl]octanoate |
| PubChem CID | 163193295 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | methyl 8-[(5R)-2-[(E,2R)-2-hydroxypent-3-enyl]-5-methoxy-3-oxocyclopenten-1-yl]octanoate |
| SMILES | C/C=C/[C@H](O)CC1=C(CCCCCCCC(=O)OC)[C@H](OC)CC1=O |
| InChI | InChI=1S/C20H32O5/c1-4-10-15(21)13-17-16(19(24-2)14-18(17)22)11-8-6-5-7-9-12-20(23)25-3/h4,10,15,19,21H,5-9,11-14H2,1-3H3/b10-4+/t15-,19+/m0/s1 |
| InChIKey | NUBCAXKWKWEUNG-FLMOZYKRSA-N |
| XLogP | 3.50 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 8-[(5R)-2-[(E,2R)-2-hydroxypent-3-enyl]-5-methoxy-3-oxocyclopenten-1-yl]octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-[(5R)-2-[(E,2R)-2-hydroxypent-3-enyl]-5-methoxy-3-oxocyclopenten-1-yl]octanoate?
The IUPAC name of methyl 8-[(5R)-2-[(E,2R)-2-hydroxypent-3-enyl]-5-methoxy-3-oxocyclopenten-1-yl]octanoate (CID 163193295) is methyl 8-[(5R)-2-[(E,2R)-2-hydroxypent-3-enyl]-5-methoxy-3-oxocyclopenten-1-yl]octanoate.
What is the SMILES notation for methyl 8-[(5R)-2-[(E,2R)-2-hydroxypent-3-enyl]-5-methoxy-3-oxocyclopenten-1-yl]octanoate?
The canonical SMILES for methyl 8-[(5R)-2-[(E,2R)-2-hydroxypent-3-enyl]-5-methoxy-3-oxocyclopenten-1-yl]octanoate is C/C=C/[C@H](O)CC1=C(CCCCCCCC(=O)OC)[C@H](OC)CC1=O.
What is the InChIKey of methyl 8-[(5R)-2-[(E,2R)-2-hydroxypent-3-enyl]-5-methoxy-3-oxocyclopenten-1-yl]octanoate?
The InChIKey is NUBCAXKWKWEUNG-FLMOZYKRSA-N. The full InChI is InChI=1S/C20H32O5/c1-4-10-15(21)13-17-16(19(24-2)14-18(17)22)11-8-6-5-7-9-12-20(23)25-3/h4,10,15,19,21H,5-9,11-14H2,1-3H3/b10-4+/t15-,19+/m0/s1.
What are the key properties of methyl 8-[(5R)-2-[(E,2R)-2-hydroxypent-3-enyl]-5-methoxy-3-oxocyclopenten-1-yl]octanoate?
methyl 8-[(5R)-2-[(E,2R)-2-hydroxypent-3-enyl]-5-methoxy-3-oxocyclopenten-1-yl]octanoate has a molecular weight of 352.47 g/mol, XLogP of 3.50, 12 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-[(5R)-2-[(E,2R)-2-hydroxypent-3-enyl]-5-methoxy-3-oxocyclopenten-1-yl]octanoate is sourced from PubChem (CID 163193295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).