C15H20N2O7 — CID 163193313
6,7-dimethyl-4-[(1S,2R,3R,4R)-1,2,3,4,5-pentahydroxypentyl]-1H-quinoxaline-2,3-dione (PubChem CID 163193313) has the molecular formula C15H20N2O7 and a molecular weight of 340.33 g/mol. Its IUPAC name is 6,7-dimethyl-4-[(1S,2R,3R,4R)-1,2,3,4,5-pentahydroxypentyl]-1H-quinoxaline-2,3-dione.
| Compound Name | 6,7-dimethyl-4-[(1S,2R,3R,4R)-1,2,3,4,5-pentahydroxypentyl]-1H-quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 163193313 |
| Molecular Formula | C15H20N2O7 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 6,7-dimethyl-4-[(1S,2R,3R,4R)-1,2,3,4,5-pentahydroxypentyl]-1H-quinoxaline-2,3-dione |
| SMILES | Cc1cc2[nH]c(=O)c(=O)n([C@@H](O)[C@H](O)[C@H](O)[C@H](O)CO)c2cc1C |
| InChI | InChI=1S/C15H20N2O7/c1-6-3-8-9(4-7(6)2)17(15(24)13(22)16-8)14(23)12(21)11(20)10(19)5-18/h3-4,10-12,14,18-21,23H,5H2,1-2H3,(H,16,22)/t10-,11-,12-,14+/m1/s1 |
| InChIKey | HTKFTZMDKALSBR-BYNQJWBRSA-N |
| XLogP | -2.13 |
| TPSA | 156.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|