C24H32O6 — CID 163193676
[(1S,4aS,7R,8E,11aR)-7-acetyloxy-7-methyl-11-methylidene-4-(4-methylpent-3-enoyl)-1,4a,5,6,10,11a-hexahydrocyclonona[c]pyran-1-yl] acetate (PubChem CID 163193676) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is [(1S,4aS,7R,8E,11aR)-7-acetyloxy-7-methyl-11-methylidene-4-(4-methylpent-3-enoyl)-1,4a,5,6,10,11a-hexahydrocyclonona[c]pyran-1-yl] acetate.
| Compound Name | [(1S,4aS,7R,8E,11aR)-7-acetyloxy-7-methyl-11-methylidene-4-(4-methylpent-3-enoyl)-1,4a,5,6,10,11a-hexahydrocyclonona[c]pyran-1-yl] acetate |
|---|---|
| PubChem CID | 163193676 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | [(1S,4aS,7R,8E,11aR)-7-acetyloxy-7-methyl-11-methylidene-4-(4-methylpent-3-enoyl)-1,4a,5,6,10,11a-hexahydrocyclonona[c]pyran-1-yl] acetate |
| SMILES | C=C1C/C=C/[C@](C)(OC(C)=O)CC[C@@H]2C(C(=O)CC=C(C)C)=CO[C@@H](OC(C)=O)[C@@H]12 |
| InChI | InChI=1S/C24H32O6/c1-15(2)9-10-21(27)20-14-28-23(29-17(4)25)22-16(3)8-7-12-24(6,30-18(5)26)13-11-19(20)22/h7,9,12,14,19,22-23H,3,8,10-11,13H2,1-2,4-6H3/b12-7+/t19-,22+,23+,24+/m1/s1 |
| InChIKey | WNLWGGVNWFODGH-YPNMWTBGSA-N |
| XLogP | 4.57 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|