C23H38O2 — CID 163193706
(4R)-4-[(2S,4bS,8aS)-2,4b,8,8-tetramethyl-3,4,5,6,7,8a,9,10-octahydro-1H-phenanthren-2-yl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 163193706) has the molecular formula C23H38O2 and a molecular weight of 346.56 g/mol. Its IUPAC name is (4R)-4-[(2S,4bS,8aS)-2,4b,8,8-tetramethyl-3,4,5,6,7,8a,9,10-octahydro-1H-phenanthren-2-yl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R)-4-[(2S,4bS,8aS)-2,4b,8,8-tetramethyl-3,4,5,6,7,8a,9,10-octahydro-1H-phenanthren-2-yl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 163193706 |
| Molecular Formula | C23H38O2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.29 |
| IUPAC Name | (4R)-4-[(2S,4bS,8aS)-2,4b,8,8-tetramethyl-3,4,5,6,7,8a,9,10-octahydro-1H-phenanthren-2-yl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)OC[C@@H]([C@@]2(C)CCC3=C(CC[C@H]4C(C)(C)CCC[C@]34C)C2)O1 |
| InChI | InChI=1S/C23H38O2/c1-20(2)11-7-12-23(6)17-10-13-22(5,14-16(17)8-9-18(20)23)19-15-24-21(3,4)25-19/h18-19H,7-15H2,1-6H3/t18-,19-,22-,23+/m0/s1 |
| InChIKey | XDXYMZCWPWXFQU-DHNNRRLOSA-N |
| XLogP | 6.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|