C16H16O3 — CID 163193710
[(3S,4E,6E)-1-hydroxytetradeca-4,6-dien-8,10,12-triyn-3-yl] acetate (PubChem CID 163193710) has the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. Its IUPAC name is [(3S,4E,6E)-1-hydroxytetradeca-4,6-dien-8,10,12-triyn-3-yl] acetate.
| Compound Name | [(3S,4E,6E)-1-hydroxytetradeca-4,6-dien-8,10,12-triyn-3-yl] acetate |
|---|---|
| PubChem CID | 163193710 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | [(3S,4E,6E)-1-hydroxytetradeca-4,6-dien-8,10,12-triyn-3-yl] acetate |
| SMILES | CC#CC#CC#C/C=C/C=C/[C@H](CCO)OC(C)=O |
| InChI | InChI=1S/C16H16O3/c1-3-4-5-6-7-8-9-10-11-12-16(13-14-17)19-15(2)18/h9-12,16-17H,13-14H2,1-2H3/b10-9+,12-11+/t16-/m1/s1 |
| InChIKey | VKMIPGGGIMVLND-ACSYMRAHSA-N |
| XLogP | 1.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|