C20H32O6 — CID 163193845
[(1S,2S,4aR,8aR)-1-hydroxy-1,4a-dimethyl-6-oxo-7-propan-2-ylidene-2,3,4,5,8,8a-hexahydronaphthalen-2-yl] (2S,3S)-2,3-dihydroxy-2-methylbutanoate (PubChem CID 163193845) has the molecular formula C20H32O6 and a molecular weight of 368.47 g/mol. Its IUPAC name is [(1S,2S,4aR,8aR)-1-hydroxy-1,4a-dimethyl-6-oxo-7-propan-2-ylidene-2,3,4,5,8,8a-hexahydronaphthalen-2-yl] (2S,3S)-2,3-dihydroxy-2-methylbutanoate.
| Compound Name | [(1S,2S,4aR,8aR)-1-hydroxy-1,4a-dimethyl-6-oxo-7-propan-2-ylidene-2,3,4,5,8,8a-hexahydronaphthalen-2-yl] (2S,3S)-2,3-dihydroxy-2-methylbutanoate |
|---|---|
| PubChem CID | 163193845 |
| Molecular Formula | C20H32O6 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | [(1S,2S,4aR,8aR)-1-hydroxy-1,4a-dimethyl-6-oxo-7-propan-2-ylidene-2,3,4,5,8,8a-hexahydronaphthalen-2-yl] (2S,3S)-2,3-dihydroxy-2-methylbutanoate |
| SMILES | CC(C)=C1C[C@@H]2[C@](C)(CC[C@H](OC(=O)[C@@](C)(O)[C@H](C)O)[C@@]2(C)O)CC1=O |
| InChI | InChI=1S/C20H32O6/c1-11(2)13-9-15-18(4,10-14(13)22)8-7-16(20(15,6)25)26-17(23)19(5,24)12(3)21/h12,15-16,21,24-25H,7-10H2,1-6H3/t12-,15+,16-,18+,19-,20-/m0/s1 |
| InChIKey | XZJZTSNVPYIDKK-LHLWPPBNSA-N |
| XLogP | 1.90 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|