C20H30O4 — CID 163194105
[(1R,4S,6S)-4-[(2R)-6-methylhept-5-en-2-yl]-5-oxo-7-oxabicyclo[4.1.0]heptan-1-yl]methyl (Z)-2-methylbut-2-enoate (PubChem CID 163194105) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is [(1R,4S,6S)-4-[(2R)-6-methylhept-5-en-2-yl]-5-oxo-7-oxabicyclo[4.1.0]heptan-1-yl]methyl (Z)-2-methylbut-2-enoate.
| Compound Name | [(1R,4S,6S)-4-[(2R)-6-methylhept-5-en-2-yl]-5-oxo-7-oxabicyclo[4.1.0]heptan-1-yl]methyl (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163194105 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | [(1R,4S,6S)-4-[(2R)-6-methylhept-5-en-2-yl]-5-oxo-7-oxabicyclo[4.1.0]heptan-1-yl]methyl (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)OC[C@]12CC[C@@H]([C@H](C)CCC=C(C)C)C(=O)[C@H]1O2 |
| InChI | InChI=1S/C20H30O4/c1-6-14(4)19(22)23-12-20-11-10-16(17(21)18(20)24-20)15(5)9-7-8-13(2)3/h6,8,15-16,18H,7,9-12H2,1-5H3/b14-6-/t15-,16+,18-,20-/m1/s1 |
| InChIKey | JPLWCRKPJJCGPH-QRXSQLFASA-N |
| XLogP | 3.99 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|