C20H24O11 — CID 163194506
(1S,4S,8R,10S,11R,14S)-11-acetyl-5-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-7,9,13-trioxatetracyclo[6.5.1.01,10.04,14]tetradeca-2,5-dien-12-one (PubChem CID 163194506) has the molecular formula C20H24O11 and a molecular weight of 440.40 g/mol. Its IUPAC name is (1S,4S,8R,10S,11R,14S)-11-acetyl-5-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-7,9,13-trioxatetracyclo[6.5.1.01,10.04,14]tetradeca-2,5-dien-12-one.
| Compound Name | (1S,4S,8R,10S,11R,14S)-11-acetyl-5-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-7,9,13-trioxatetracyclo[6.5.1.01,10.04,14]tetradeca-2,5-dien-12-one |
|---|---|
| PubChem CID | 163194506 |
| Molecular Formula | C20H24O11 |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | (1S,4S,8R,10S,11R,14S)-11-acetyl-5-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-7,9,13-trioxatetracyclo[6.5.1.01,10.04,14]tetradeca-2,5-dien-12-one |
| SMILES | CC(=O)[C@@H]1C(=O)O[C@]23C=C[C@@H]4C(CO[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)=CO[C@H](O[C@@H]12)[C@@H]43 |
| InChI | InChI=1S/C20H24O11/c1-7(22)11-16-20(31-17(11)26)3-2-9-8(5-27-18(30-16)12(9)20)6-28-19-15(25)14(24)13(23)10(4-21)29-19/h2-3,5,9-16,18-19,21,23-25H,4,6H2,1H3/t9-,10-,11+,12-,13-,14+,15-,16+,18-,19-,20+/m1/s1 |
| InChIKey | UNCJQTHDRJLHFL-TVRKKJECSA-N |
| XLogP | -2.26 |
| TPSA | 161.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|