About (6S)-4-bromo-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-ene
(6S)-4-bromo-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-ene (PubChem CID 163194822) has the molecular formula C15H23Br
and a molecular weight of 283.25 g/mol. Its IUPAC name is (6S)-4-bromo-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-ene.
Molecular Properties
| Compound Name | (6S)-4-bromo-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-ene |
| PubChem CID | 163194822 |
| Molecular Formula | C15H23Br |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | (6S)-4-bromo-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-ene |
| SMILES | C=C1CCC(Br)C(C)(C)[C@@]12CC=C(C)CC2 |
| InChI | InChI=1S/C15H23Br/c1-11-7-9-15(10-8-11)12(2)5-6-13(16)14(15,3)4/h7,13H,2,5-6,8-10H2,1,3-4H3/t13?,15-/m1/s1 |
| InChIKey | ZATQJGNPERFQSF-AWKYBWMHSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6S)-4-bromo-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-4-bromo-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-ene?
The IUPAC name of (6S)-4-bromo-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-ene (CID 163194822) is (6S)-4-bromo-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-ene.
What is the SMILES notation for (6S)-4-bromo-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-ene?
The canonical SMILES for (6S)-4-bromo-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-ene is C=C1CCC(Br)C(C)(C)[C@@]12CC=C(C)CC2.
What is the InChIKey of (6S)-4-bromo-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-ene?
The InChIKey is ZATQJGNPERFQSF-AWKYBWMHSA-N. The full InChI is InChI=1S/C15H23Br/c1-11-7-9-15(10-8-11)12(2)5-6-13(16)14(15,3)4/h7,13H,2,5-6,8-10H2,1,3-4H3/t13?,15-/m1/s1.
What are the key properties of (6S)-4-bromo-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-ene?
(6S)-4-bromo-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-ene has a molecular weight of 283.25 g/mol, XLogP of 5.24, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-4-bromo-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-ene is sourced from PubChem (CID 163194822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).