C19H23NO5 — CID 163195013
(5Z)-5-[(1S,4S,5R,8S,9S,13R)-4,9-dimethyl-2,14-dioxa-10-azapentacyclo[6.5.1.01,5.06,10.09,13]tetradecan-3-ylidene]-4-methoxy-3-methylfuran-2-one (PubChem CID 163195013) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is (5Z)-5-[(1S,4S,5R,8S,9S,13R)-4,9-dimethyl-2,14-dioxa-10-azapentacyclo[6.5.1.01,5.06,10.09,13]tetradecan-3-ylidene]-4-methoxy-3-methylfuran-2-one.
| Compound Name | (5Z)-5-[(1S,4S,5R,8S,9S,13R)-4,9-dimethyl-2,14-dioxa-10-azapentacyclo[6.5.1.01,5.06,10.09,13]tetradecan-3-ylidene]-4-methoxy-3-methylfuran-2-one |
|---|---|
| PubChem CID | 163195013 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | (5Z)-5-[(1S,4S,5R,8S,9S,13R)-4,9-dimethyl-2,14-dioxa-10-azapentacyclo[6.5.1.01,5.06,10.09,13]tetradecan-3-ylidene]-4-methoxy-3-methylfuran-2-one |
| SMILES | COC1=C(C)C(=O)O/C1=C1\OC23O[C@H]4CC([C@H]2[C@@H]1C)N1CC[C@@H]3[C@@]41C |
| InChI | InChI=1S/C19H23NO5/c1-8-13-10-7-12-18(3)11(5-6-20(10)18)19(13,24-12)25-15(8)16-14(22-4)9(2)17(21)23-16/h8,10-13H,5-7H2,1-4H3/b16-15-/t8-,10?,11+,12-,13+,18-,19?/m0/s1 |
| InChIKey | DXTOAXQEIBYHNK-RQMAOBETSA-N |
| XLogP | 1.92 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |